C23H27N3O9S — CID 141235814
[(2R,3S,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-prop-2-enylpyrimidin-1-yl)-3-benzylsulfonyloxyoxolan-2-yl]methyl acetate (PubChem CID 141235814) has the molecular formula C23H27N3O9S and a molecular weight of 521.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-prop-2-enylpyrimidin-1-yl)-3-benzylsulfonyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-prop-2-enylpyrimidin-1-yl)-3-benzylsulfonyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 141235814 |
| Molecular Formula | C23H27N3O9S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(4-amino-2-oxo-5-prop-2-enylpyrimidin-1-yl)-3-benzylsulfonyloxyoxolan-2-yl]methyl acetate |
| SMILES | C=CCc1cn([C@@H]2O[C@H](COC(C)=O)[C@H](OS(=O)(=O)Cc3ccccc3)[C@H]2OC(C)=O)c(=O)nc1N |
| InChI | InChI=1S/C23H27N3O9S/c1-4-8-17-11-26(23(29)25-21(17)24)22-20(33-15(3)28)19(18(34-22)12-32-14(2)27)35-36(30,31)13-16-9-6-5-7-10-16/h4-7,9-11,18-20,22H,1,8,12-13H2,2-3H3,(H2,24,25,29)/t18-,19+,20-,22-/m1/s1 |
| InChIKey | PDPSPIRLHLUDJP-XAPVIXHLSA-N |
| XLogP | 0.86 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|