C26H29N3O3 — CID 156502523
benzyl N-[4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]carbamate (PubChem CID 156502523) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is benzyl N-[4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | benzyl N-[4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 156502523 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | benzyl N-[4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]carbamate |
| SMILES | CCOc1ncccc1-c1ccc(C2(NC(=O)OCc3ccccc3)CCNCC2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-2-31-24-23(9-6-16-28-24)21-10-12-22(13-11-21)26(14-17-27-18-15-26)29-25(30)32-19-20-7-4-3-5-8-20/h3-13,16,27H,2,14-15,17-19H2,1H3,(H,29,30) |
| InChIKey | KYDCKIAZOUAVLQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |