C28H25N3O3 — CID 121449255
benzyl N-[3-[4-(5-amino-3-phenyl-2-pyridinyl)phenyl]oxetan-3-yl]carbamate (PubChem CID 121449255) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is benzyl N-[3-[4-(5-amino-3-phenyl-2-pyridinyl)phenyl]oxetan-3-yl]carbamate.
| Compound Name | benzyl N-[3-[4-(5-amino-3-phenyl-2-pyridinyl)phenyl]oxetan-3-yl]carbamate |
|---|---|
| PubChem CID | 121449255 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | benzyl N-[3-[4-(5-amino-3-phenyl-2-pyridinyl)phenyl]oxetan-3-yl]carbamate |
| SMILES | Nc1cnc(-c2ccc(C3(NC(=O)OCc4ccccc4)COC3)cc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H25N3O3/c29-24-15-25(21-9-5-2-6-10-21)26(30-16-24)22-11-13-23(14-12-22)28(18-33-19-28)31-27(32)34-17-20-7-3-1-4-8-20/h1-16H,17-19,29H2,(H,31,32) |
| InChIKey | OIBIEHQEMVUARY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |