C30H37N5O4 — CID 146361511
benzyl N-[2-[[5-(2-ethoxy-3-pyridinyl)-2-[(2R)-2-ethylpiperazin-1-yl]benzoyl]amino]ethyl]carbamate (PubChem CID 146361511) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is benzyl N-[2-[[5-(2-ethoxy-3-pyridinyl)-2-[(2R)-2-ethylpiperazin-1-yl]benzoyl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[5-(2-ethoxy-3-pyridinyl)-2-[(2R)-2-ethylpiperazin-1-yl]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146361511 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | benzyl N-[2-[[5-(2-ethoxy-3-pyridinyl)-2-[(2R)-2-ethylpiperazin-1-yl]benzoyl]amino]ethyl]carbamate |
| SMILES | CCOc1ncccc1-c1ccc(N2CCNC[C@H]2CC)c(C(=O)NCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H37N5O4/c1-3-24-20-31-17-18-35(24)27-13-12-23(25-11-8-14-33-29(25)38-4-2)19-26(27)28(36)32-15-16-34-30(37)39-21-22-9-6-5-7-10-22/h5-14,19,24,31H,3-4,15-18,20-21H2,1-2H3,(H,32,36)(H,34,37)/t24-/m1/s1 |
| InChIKey | QQQCJIFENXOGNF-XMMPIXPASA-N |
| XLogP | 3.99 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|