C19H22N4O2 — CID 164850769
benzyl N-[(7-pyrimidin-2-yl-3-azabicyclo[4.1.0]heptan-7-yl)methyl]carbamate (PubChem CID 164850769) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is benzyl N-[(7-pyrimidin-2-yl-3-azabicyclo[4.1.0]heptan-7-yl)methyl]carbamate.
| Compound Name | benzyl N-[(7-pyrimidin-2-yl-3-azabicyclo[4.1.0]heptan-7-yl)methyl]carbamate |
|---|---|
| PubChem CID | 164850769 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | benzyl N-[(7-pyrimidin-2-yl-3-azabicyclo[4.1.0]heptan-7-yl)methyl]carbamate |
| SMILES | O=C(NCC1(c2ncccn2)C2CCNCC21)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N4O2/c24-18(25-12-14-5-2-1-3-6-14)23-13-19(17-21-8-4-9-22-17)15-7-10-20-11-16(15)19/h1-6,8-9,15-16,20H,7,10-13H2,(H,23,24) |
| InChIKey | WUCWTMXGCUSZGN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |