C22H28N2O4 — CID 164888782
benzyl N-[5-[4-(azetidin-3-yloxy)phenoxy]pentyl]carbamate (PubChem CID 164888782) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is benzyl N-[5-[4-(azetidin-3-yloxy)phenoxy]pentyl]carbamate.
| Compound Name | benzyl N-[5-[4-(azetidin-3-yloxy)phenoxy]pentyl]carbamate |
|---|---|
| PubChem CID | 164888782 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | benzyl N-[5-[4-(azetidin-3-yloxy)phenoxy]pentyl]carbamate |
| SMILES | O=C(NCCCCCOc1ccc(OC2CNC2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c25-22(27-17-18-7-3-1-4-8-18)24-13-5-2-6-14-26-19-9-11-20(12-10-19)28-21-15-23-16-21/h1,3-4,7-12,21,23H,2,5-6,13-17H2,(H,24,25) |
| InChIKey | XLBBYCRHAHJVHT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|