C26H37NO4 — CID 175497436
[3-(phenylmethoxycarbonylamino)-1-adamantyl] octanoate (PubChem CID 175497436) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is [3-(phenylmethoxycarbonylamino)-1-adamantyl] octanoate.
| Compound Name | [3-(phenylmethoxycarbonylamino)-1-adamantyl] octanoate |
|---|---|
| PubChem CID | 175497436 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | [3-(phenylmethoxycarbonylamino)-1-adamantyl] octanoate |
| SMILES | CCCCCCCC(=O)OC12CC3CC(CC(NC(=O)OCc4ccccc4)(C3)C1)C2 |
| InChI | InChI=1S/C26H37NO4/c1-2-3-4-5-9-12-23(28)31-26-16-21-13-22(17-26)15-25(14-21,19-26)27-24(29)30-18-20-10-7-6-8-11-20/h6-8,10-11,21-22H,2-5,9,12-19H2,1H3,(H,27,29) |
| InChIKey | KXMOIHGSSGLHHS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|