C29H36N2O2 — CID 4660551
N-(1-adamantyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carboxamide (PubChem CID 4660551) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carboxamide.
| Compound Name | N-(1-adamantyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 4660551 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-(1-adamantyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H36N2O2/c32-27(30-28-18-21-15-22(19-28)17-23(16-21)20-28)31-13-11-26(12-14-31)29(33,24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-10,21-23,26,33H,11-20H2,(H,30,32) |
| InChIKey | RFCMYAPBKUMPKY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |