C15H26ClN3O — CID 154904087
N-(1-adamantyl)-3-aminopyrrolidine-1-carboxamide;hydrochloride (PubChem CID 154904087) has the molecular formula C15H26ClN3O and a molecular weight of 299.85 g/mol. Its IUPAC name is N-(1-adamantyl)-3-aminopyrrolidine-1-carboxamide;hydrochloride.
| Compound Name | N-(1-adamantyl)-3-aminopyrrolidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154904087 |
| Molecular Formula | C15H26ClN3O |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-(1-adamantyl)-3-aminopyrrolidine-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)NC23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C15H25N3O.ClH/c16-13-1-2-18(9-13)14(19)17-15-6-10-3-11(7-15)5-12(4-10)8-15;/h10-13H,1-9,16H2,(H,17,19);1H |
| InChIKey | HNCHDRMFDVMFKV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |