About 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride
2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride (PubChem CID 67155573) has the molecular formula C15H25ClN2O2
and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride |
| PubChem CID | 67155573 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)OC2C3CC4CC(C3)CC2C4)C1 |
| InChI | InChI=1S/C15H24N2O2.ClH/c16-13-1-2-17(8-13)15(18)19-14-11-4-9-3-10(6-11)7-12(14)5-9;/h9-14H,1-8,16H2;1H |
| InChIKey | RTZIAEXRSWAYRP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride?
The IUPAC name of 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride (CID 67155573) is 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride.
What is the SMILES notation for 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride?
The canonical SMILES for 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride is Cl.NC1CCN(C(=O)OC2C3CC4CC(C3)CC2C4)C1.
What is the InChIKey of 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride?
The InChIKey is RTZIAEXRSWAYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2.ClH/c16-13-1-2-17(8-13)15(18)19-14-11-4-9-3-10(6-11)7-12(14)5-9;/h9-14H,1-8,16H2;1H.
What are the key properties of 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride?
2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride has a molecular weight of 300.83 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl 3-aminopyrrolidine-1-carboxylate;hydrochloride is sourced from PubChem (CID 67155573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).