C23H33N3O2 — CID 90595914
1-(1-adamantyl)-3-[4-(4-methoxypiperidin-1-yl)phenyl]urea (PubChem CID 90595914) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-(4-methoxypiperidin-1-yl)phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-(4-methoxypiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 90595914 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-(4-methoxypiperidin-1-yl)phenyl]urea |
| SMILES | COC1CCN(c2ccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)CC1 |
| InChI | InChI=1S/C23H33N3O2/c1-28-21-6-8-26(9-7-21)20-4-2-19(3-5-20)24-22(27)25-23-13-16-10-17(14-23)12-18(11-16)15-23/h2-5,16-18,21H,6-15H2,1H3,(H2,24,25,27) |
| InChIKey | GVSLPOKDUCSIAB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|