C35H38N4O3 — CID 3494110
1-(1-adamantyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea (PubChem CID 3494110) has the molecular formula C35H38N4O3 and a molecular weight of 562.71 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 3494110 |
| Molecular Formula | C35H38N4O3 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H38N4O3/c40-33(32-28-5-1-3-7-30(28)42-31-8-4-2-6-29(31)32)39-15-13-38(14-16-39)27-11-9-26(10-12-27)36-34(41)37-35-20-23-17-24(21-35)19-25(18-23)22-35/h1-12,23-25,32H,13-22H2,(H2,36,37,41) |
| InChIKey | YYSVVPAWTLPBDH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|