C34H32N4O5 — CID 1058018
ethyl 4-[[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]carbamoylamino]benzoate (PubChem CID 1058018) has the molecular formula C34H32N4O5 and a molecular weight of 576.65 g/mol. Its IUPAC name is ethyl 4-[[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 1058018 |
| Molecular Formula | C34H32N4O5 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | ethyl 4-[[4-[4-(9H-xanthene-9-carbonyl)piperazin-1-yl]phenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)C4c5ccccc5Oc5ccccc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H32N4O5/c1-2-42-33(40)23-11-13-24(14-12-23)35-34(41)36-25-15-17-26(18-16-25)37-19-21-38(22-20-37)32(39)31-27-7-3-5-9-29(27)43-30-10-6-4-8-28(30)31/h3-18,31H,2,19-22H2,1H3,(H2,35,36,41) |
| InChIKey | DDMOZVSCTYKFFC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|