C16H21ClN2O2 — CID 108957492
N-(2-chloro-4,6-dimethylphenyl)-N'-cyclopropyl-2,2-dimethylpropanediamide (PubChem CID 108957492) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N'-cyclopropyl-2,2-dimethylpropanediamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N'-cyclopropyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108957492 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N'-cyclopropyl-2,2-dimethylpropanediamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)(C)C(=O)NC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O2/c1-9-7-10(2)13(12(17)8-9)19-15(21)16(3,4)14(20)18-11-5-6-11/h7-8,11H,5-6H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | YJXGYZRATLGITG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|