C10H10F4N2O — CID 114032448
N-(2-amino-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 114032448) has the molecular formula C10H10F4N2O and a molecular weight of 250.20 g/mol. Its IUPAC name is N-(2-amino-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-amino-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 114032448 |
| Molecular Formula | C10H10F4N2O |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | N-(2-amino-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | Cc1ccc(N)c(NC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H10F4N2O/c1-5-2-3-6(15)7(4-5)16-9(17)10(13,14)8(11)12/h2-4,8H,15H2,1H3,(H,16,17) |
| InChIKey | MSLLQPYJCMAGDC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|