C14H18BrNO2 — CID 112738566
cyclopentyl N-(2-bromo-4,6-dimethylphenyl)carbamate (PubChem CID 112738566) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is cyclopentyl N-(2-bromo-4,6-dimethylphenyl)carbamate.
| Compound Name | cyclopentyl N-(2-bromo-4,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 112738566 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | cyclopentyl N-(2-bromo-4,6-dimethylphenyl)carbamate |
| SMILES | Cc1cc(C)c(NC(=O)OC2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H18BrNO2/c1-9-7-10(2)13(12(15)8-9)16-14(17)18-11-5-3-4-6-11/h7-8,11H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | TVPQDYHDCJIDIY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |