C12H12BrClFNO2 — CID 112738568
cyclopentyl N-(2-bromo-6-chloro-4-fluorophenyl)carbamate (PubChem CID 112738568) has the molecular formula C12H12BrClFNO2 and a molecular weight of 336.59 g/mol. Its IUPAC name is cyclopentyl N-(2-bromo-6-chloro-4-fluorophenyl)carbamate.
| Compound Name | cyclopentyl N-(2-bromo-6-chloro-4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 112738568 |
| Molecular Formula | C12H12BrClFNO2 |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | cyclopentyl N-(2-bromo-6-chloro-4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1c(Cl)cc(F)cc1Br)OC1CCCC1 |
| InChI | InChI=1S/C12H12BrClFNO2/c13-9-5-7(15)6-10(14)11(9)16-12(17)18-8-3-1-2-4-8/h5-6,8H,1-4H2,(H,16,17) |
| InChIKey | QLPXZLDROKTDBH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |