C14H10BrCl2FN2O — CID 107612539
N-(2-bromo-6-chloro-4-fluorophenyl)-4-chloro-1-cyclopropylpyrrole-2-carboxamide (PubChem CID 107612539) has the molecular formula C14H10BrCl2FN2O and a molecular weight of 392.06 g/mol. Its IUPAC name is N-(2-bromo-6-chloro-4-fluorophenyl)-4-chloro-1-cyclopropylpyrrole-2-carboxamide.
| Compound Name | N-(2-bromo-6-chloro-4-fluorophenyl)-4-chloro-1-cyclopropylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107612539 |
| Molecular Formula | C14H10BrCl2FN2O |
| Molecular Weight | 392.06 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | N-(2-bromo-6-chloro-4-fluorophenyl)-4-chloro-1-cyclopropylpyrrole-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(F)cc1Br)c1cc(Cl)cn1C1CC1 |
| InChI | InChI=1S/C14H10BrCl2FN2O/c15-10-4-8(18)5-11(17)13(10)19-14(21)12-3-7(16)6-20(12)9-1-2-9/h3-6,9H,1-2H2,(H,19,21) |
| InChIKey | RRIDISNZQDIQKX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.06 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |