C14H22BrNO — CID 114493437
3-[(2-bromo-4,6-dimethylanilino)methyl]pentan-3-ol (PubChem CID 114493437) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 3-[(2-bromo-4,6-dimethylanilino)methyl]pentan-3-ol.
| Compound Name | 3-[(2-bromo-4,6-dimethylanilino)methyl]pentan-3-ol |
|---|---|
| PubChem CID | 114493437 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[(2-bromo-4,6-dimethylanilino)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C14H22BrNO/c1-5-14(17,6-2)9-16-13-11(4)7-10(3)8-12(13)15/h7-8,16-17H,5-6,9H2,1-4H3 |
| InChIKey | GSSISFIXUBLIDJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |