C12H16Cl3NO — CID 114492766
3-[(2,4,6-trichloroanilino)methyl]pentan-3-ol (PubChem CID 114492766) has the molecular formula C12H16Cl3NO and a molecular weight of 296.62 g/mol. Its IUPAC name is 3-[(2,4,6-trichloroanilino)methyl]pentan-3-ol.
| Compound Name | 3-[(2,4,6-trichloroanilino)methyl]pentan-3-ol |
|---|---|
| PubChem CID | 114492766 |
| Molecular Formula | C12H16Cl3NO |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-[(2,4,6-trichloroanilino)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl3NO/c1-3-12(17,4-2)7-16-11-9(14)5-8(13)6-10(11)15/h5-6,16-17H,3-4,7H2,1-2H3 |
| InChIKey | MEABMYGJDQOAJY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |