C14H22N2 — CID 161054115
N-ethyl-2,6-dimethyl-4-propylaniline;formonitrile (PubChem CID 161054115) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-ethyl-2,6-dimethyl-4-propylaniline;formonitrile.
| Compound Name | N-ethyl-2,6-dimethyl-4-propylaniline;formonitrile |
|---|---|
| PubChem CID | 161054115 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-ethyl-2,6-dimethyl-4-propylaniline;formonitrile |
| SMILES | C#N.CCCc1cc(C)c(NCC)c(C)c1 |
| InChI | InChI=1S/C13H21N.CHN/c1-5-7-12-8-10(3)13(14-6-2)11(4)9-12;1-2/h8-9,14H,5-7H2,1-4H3;1H |
| InChIKey | UCNCONHCGFEZRS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |