C11H15I — CID 171831692
1-iodo-2,3-dimethyl-5-propylbenzene (PubChem CID 171831692) has the molecular formula C11H15I and a molecular weight of 274.14 g/mol. Its IUPAC name is 1-iodo-2,3-dimethyl-5-propylbenzene.
| Compound Name | 1-iodo-2,3-dimethyl-5-propylbenzene |
|---|---|
| PubChem CID | 171831692 |
| Molecular Formula | C11H15I |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-iodo-2,3-dimethyl-5-propylbenzene |
| SMILES | CCCc1cc(C)c(C)c(I)c1 |
| InChI | InChI=1S/C11H15I/c1-4-5-10-6-8(2)9(3)11(12)7-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | SNSHNBHGMJGGEE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|