C12H19NS — CID 174992076
[3-(ethylamino)-2,4,5-trimethylphenyl]methanethiol (PubChem CID 174992076) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is [3-(ethylamino)-2,4,5-trimethylphenyl]methanethiol.
| Compound Name | [3-(ethylamino)-2,4,5-trimethylphenyl]methanethiol |
|---|---|
| PubChem CID | 174992076 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | [3-(ethylamino)-2,4,5-trimethylphenyl]methanethiol |
| SMILES | CCNc1c(C)c(C)cc(CS)c1C |
| InChI | InChI=1S/C12H19NS/c1-5-13-12-9(3)8(2)6-11(7-14)10(12)4/h6,13-14H,5,7H2,1-4H3 |
| InChIKey | IUYMPSNCXJLUFJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|