C14H25N — CID 144922469
ethane;N,2,4-trimethyl-6-propylaniline (PubChem CID 144922469) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;N,2,4-trimethyl-6-propylaniline.
| Compound Name | ethane;N,2,4-trimethyl-6-propylaniline |
|---|---|
| PubChem CID | 144922469 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;N,2,4-trimethyl-6-propylaniline |
| SMILES | CC.CCCc1cc(C)cc(C)c1NC |
| InChI | InChI=1S/C12H19N.C2H6/c1-5-6-11-8-9(2)7-10(3)12(11)13-4;1-2/h7-8,13H,5-6H2,1-4H3;1-2H3 |
| InChIKey | ZGIWNGWBBCZSBZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |