C10H15NO — CID 123380294
5-methoxy-N,2,3-trimethylaniline (PubChem CID 123380294) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-methoxy-N,2,3-trimethylaniline.
| Compound Name | 5-methoxy-N,2,3-trimethylaniline |
|---|---|
| PubChem CID | 123380294 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5-methoxy-N,2,3-trimethylaniline |
| SMILES | CNc1cc(OC)cc(C)c1C |
| InChI | InChI=1S/C10H15NO/c1-7-5-9(12-4)6-10(11-3)8(7)2/h5-6,11H,1-4H3 |
| InChIKey | DFRJGTYHJAIZGS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |