C28H24N2 — CID 71202847
2,9-dimethyl-4,7-bis(4-methylphenyl)-1,10-phenanthroline (PubChem CID 71202847) has the molecular formula C28H24N2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2,9-dimethyl-4,7-bis(4-methylphenyl)-1,10-phenanthroline.
| Compound Name | 2,9-dimethyl-4,7-bis(4-methylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 71202847 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2,9-dimethyl-4,7-bis(4-methylphenyl)-1,10-phenanthroline |
| SMILES | Cc1ccc(-c2cc(C)nc3c2ccc2c(-c4ccc(C)cc4)cc(C)nc23)cc1 |
| InChI | InChI=1S/C28H24N2/c1-17-5-9-21(10-6-17)25-15-19(3)29-27-23(25)13-14-24-26(16-20(4)30-28(24)27)22-11-7-18(2)8-12-22/h5-16H,1-4H3 |
| InChIKey | LUODSNXEIGJWST-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|