C27H24N2 — CID 146321201
2,9-dimethyl-4-(3-methylcyclohexa-1,5-dien-1-yl)-7-phenyl-1,10-phenanthroline (PubChem CID 146321201) has the molecular formula C27H24N2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2,9-dimethyl-4-(3-methylcyclohexa-1,5-dien-1-yl)-7-phenyl-1,10-phenanthroline.
| Compound Name | 2,9-dimethyl-4-(3-methylcyclohexa-1,5-dien-1-yl)-7-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 146321201 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2,9-dimethyl-4-(3-methylcyclohexa-1,5-dien-1-yl)-7-phenyl-1,10-phenanthroline |
| SMILES | Cc1cc(C2=CC(C)CC=C2)c2ccc3c(-c4ccccc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C27H24N2/c1-17-8-7-11-21(14-17)25-16-19(3)29-27-23(25)13-12-22-24(15-18(2)28-26(22)27)20-9-5-4-6-10-20/h4-7,9-17H,8H2,1-3H3 |
| InChIKey | NDPYBDYMAJAHPV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|