C34H49NS — CID 143093877
2-[(2Z,4E,6E,9Z)-7-cyclohexyl-2-ethenyl-5,6,11-trimethyl-8-propan-2-ylidenedodeca-2,4,6,9,11-pentaenyl]-N-methylaniline;methanethiol (PubChem CID 143093877) has the molecular formula C34H49NS and a molecular weight of 503.84 g/mol. Its IUPAC name is 2-[(2Z,4E,6E,9Z)-7-cyclohexyl-2-ethenyl-5,6,11-trimethyl-8-propan-2-ylidenedodeca-2,4,6,9,11-pentaenyl]-N-methylaniline;methanethiol.
| Compound Name | 2-[(2Z,4E,6E,9Z)-7-cyclohexyl-2-ethenyl-5,6,11-trimethyl-8-propan-2-ylidenedodeca-2,4,6,9,11-pentaenyl]-N-methylaniline;methanethiol |
|---|---|
| PubChem CID | 143093877 |
| Molecular Formula | C34H49NS |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | 2-[(2Z,4E,6E,9Z)-7-cyclohexyl-2-ethenyl-5,6,11-trimethyl-8-propan-2-ylidenedodeca-2,4,6,9,11-pentaenyl]-N-methylaniline;methanethiol |
| SMILES | C=C/C(=C\C=C(C)\C(C)=C(\C(/C=C\C(=C)C)=C(C)C)C1CCCCC1)Cc1ccccc1NC.CS |
| InChI | InChI=1S/C33H45N.CH4S/c1-9-28(23-30-17-13-14-18-32(30)34-8)21-20-26(6)27(7)33(29-15-11-10-12-16-29)31(25(4)5)22-19-24(2)3;1-2/h9,13-14,17-22,29,34H,1-2,10-12,15-16,23H2,3-8H3;2H,1H3/b22-19-,26-20+,28-21+,33-27+; |
| InChIKey | BVTIRHUSPPHGAV-XOMNEWONSA-N |
| XLogP | 10.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|