C18H17B — CID 142331512
[(3Z)-hexa-1,3,5-trien-3-yl]-diphenylborane (PubChem CID 142331512) has the molecular formula C18H17B and a molecular weight of 244.15 g/mol. Its IUPAC name is [(3Z)-hexa-1,3,5-trien-3-yl]-diphenylborane.
| Compound Name | [(3Z)-hexa-1,3,5-trien-3-yl]-diphenylborane |
|---|---|
| PubChem CID | 142331512 |
| Molecular Formula | C18H17B |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | [(3Z)-hexa-1,3,5-trien-3-yl]-diphenylborane |
| SMILES | C=C/C=C(\C=C)B(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17B/c1-3-11-16(4-2)19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h3-15H,1-2H2/b16-11+ |
| InChIKey | ULIZYZDBGCUSJE-LFIBNONCSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|