C31H35N3O2S — CID 19045712
N-[5-[(3-aminophenyl)methylamino]-2,2-diphenylpentyl]-4-methylbenzenesulfonamide (PubChem CID 19045712) has the molecular formula C31H35N3O2S and a molecular weight of 513.71 g/mol. Its IUPAC name is N-[5-[(3-aminophenyl)methylamino]-2,2-diphenylpentyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-[(3-aminophenyl)methylamino]-2,2-diphenylpentyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 19045712 |
| Molecular Formula | C31H35N3O2S |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-[5-[(3-aminophenyl)methylamino]-2,2-diphenylpentyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(CCCNCc2cccc(N)c2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H35N3O2S/c1-25-16-18-30(19-17-25)37(35,36)34-24-31(27-11-4-2-5-12-27,28-13-6-3-7-14-28)20-9-21-33-23-26-10-8-15-29(32)22-26/h2-8,10-19,22,33-34H,9,20-21,23-24,32H2,1H3 |
| InChIKey | VNKXTUAIMLQVGH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|