C16H17NO2S — CID 175348240
N-[(3-ethenylphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 175348240) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-[(3-ethenylphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3-ethenylphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 175348240 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[(3-ethenylphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | C=Cc1cccc(CNS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C16H17NO2S/c1-3-14-5-4-6-15(11-14)12-17-20(18,19)16-9-7-13(2)8-10-16/h3-11,17H,1,12H2,2H3 |
| InChIKey | ZPLVMIWQKNHTOM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |