C17H22N3O2S+ — CID 91934659
1-aminoethylidene-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]azanium (PubChem CID 91934659) has the molecular formula C17H22N3O2S+ and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-aminoethylidene-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]azanium.
| Compound Name | 1-aminoethylidene-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 91934659 |
| Molecular Formula | C17H22N3O2S+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-aminoethylidene-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]azanium |
| SMILES | C/C(N)=[NH+]\Cc1cccc(CNS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C17H21N3O2S/c1-13-6-8-17(9-7-13)23(21,22)20-12-16-5-3-4-15(10-16)11-19-14(2)18/h3-10,20H,11-12H2,1-2H3,(H2,18,19)/p+1 |
| InChIKey | HRGKQLBKMDIDKN-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|