C24H24N2O4S2 — CID 102497482
4-methyl-N-[2-(4-nitrophenyl)sulfanyl-2-phenylpent-4-enyl]benzenesulfonamide (PubChem CID 102497482) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-methyl-N-[2-(4-nitrophenyl)sulfanyl-2-phenylpent-4-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(4-nitrophenyl)sulfanyl-2-phenylpent-4-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102497482 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-methyl-N-[2-(4-nitrophenyl)sulfanyl-2-phenylpent-4-enyl]benzenesulfonamide |
| SMILES | C=CCC(CNS(=O)(=O)c1ccc(C)cc1)(Sc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S2/c1-3-17-24(20-7-5-4-6-8-20,31-22-13-11-21(12-14-22)26(27)28)18-25-32(29,30)23-15-9-19(2)10-16-23/h3-16,25H,1,17-18H2,2H3 |
| InChIKey | IKSDOXCDYGCDOR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|