C11H19BrN2O2S — CID 123816444
trimethyl-[[(4-methylphenyl)sulfonylamino]methyl]azanium bromide (PubChem CID 123816444) has the molecular formula C11H19BrN2O2S and a molecular weight of 323.26 g/mol. Its IUPAC name is trimethyl-[[(4-methylphenyl)sulfonylamino]methyl]azanium bromide.
| Compound Name | trimethyl-[[(4-methylphenyl)sulfonylamino]methyl]azanium bromide |
|---|---|
| PubChem CID | 123816444 |
| Molecular Formula | C11H19BrN2O2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | trimethyl-[[(4-methylphenyl)sulfonylamino]methyl]azanium bromide |
| SMILES | Cc1ccc(S(=O)(=O)NC[N+](C)(C)C)cc1.[Br-] |
| InChI | InChI=1S/C11H19N2O2S.BrH/c1-10-5-7-11(8-6-10)16(14,15)12-9-13(2,3)4;/h5-8,12H,9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RXNNSXBFIYDDLR-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|