C13H18FNO4S — CID 62826714
3-[ethyl-(2-fluoro-5-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 62826714) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is 3-[ethyl-(2-fluoro-5-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 3-[ethyl-(2-fluoro-5-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 62826714 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-[ethyl-(2-fluoro-5-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | CCN(C(C)CC(=O)O)S(=O)(=O)c1cc(C)ccc1F |
| InChI | InChI=1S/C13H18FNO4S/c1-4-15(10(3)8-13(16)17)20(18,19)12-7-9(2)5-6-11(12)14/h5-7,10H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | BVQFNYKSOLNZCB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |