C11H17FN2O4S2 — CID 63767352
N-(2-aminopropyl)-2-fluoro-N-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 63767352) has the molecular formula C11H17FN2O4S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(2-aminopropyl)-2-fluoro-N-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-aminopropyl)-2-fluoro-N-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 63767352 |
| Molecular Formula | C11H17FN2O4S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-(2-aminopropyl)-2-fluoro-N-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | CC(N)CN(C)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C11H17FN2O4S2/c1-8(13)7-14(2)20(17,18)11-6-9(19(3,15)16)4-5-10(11)12/h4-6,8H,7,13H2,1-3H3 |
| InChIKey | OGYZPEKQWGDCKP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |