C10H15FN2O4S — CID 61140970
5-amino-2-fluoro-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 61140970) has the molecular formula C10H15FN2O4S and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-amino-2-fluoro-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61140970 |
| Molecular Formula | C10H15FN2O4S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 5-amino-2-fluoro-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1ccc(F)c(S(=O)(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C10H15FN2O4S/c11-9-2-1-8(12)7-10(9)18(16,17)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6,12H2 |
| InChIKey | ZXYCTZCDALFIGB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|