C10H18ClN3O2S — CID 106145933
N-(4-chloro-2,2-dimethylbutyl)-2-methylpyrazole-3-sulfonamide (PubChem CID 106145933) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106145933 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NCC(C)(C)CCCl |
| InChI | InChI=1S/C10H18ClN3O2S/c1-10(2,5-6-11)8-13-17(15,16)9-4-7-12-14(9)3/h4,7,13H,5-6,8H2,1-3H3 |
| InChIKey | UPCJMTJWBZIABG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|