C12H20ClNO2S2 — CID 106146122
N-(5-chloro-2,2-dimethylpentyl)-5-methylthiophene-2-sulfonamide (PubChem CID 106146122) has the molecular formula C12H20ClNO2S2 and a molecular weight of 309.88 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106146122 |
| Molecular Formula | C12H20ClNO2S2 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)(C)CCCCl)s1 |
| InChI | InChI=1S/C12H20ClNO2S2/c1-10-5-6-11(17-10)18(15,16)14-9-12(2,3)7-4-8-13/h5-6,14H,4,7-9H2,1-3H3 |
| InChIKey | HSDKMAFUAXUQJE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|