C18H22N2O2S2 — CID 113085743
5-methyl-N-[2-methyl-2-(2-methyl-1H-indol-3-yl)propyl]thiophene-2-sulfonamide (PubChem CID 113085743) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 5-methyl-N-[2-methyl-2-(2-methyl-1H-indol-3-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-methyl-2-(2-methyl-1H-indol-3-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113085743 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-methyl-N-[2-methyl-2-(2-methyl-1H-indol-3-yl)propyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)(C)c2c(C)[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C18H22N2O2S2/c1-12-9-10-16(23-12)24(21,22)19-11-18(3,4)17-13(2)20-15-8-6-5-7-14(15)17/h5-10,19-20H,11H2,1-4H3 |
| InChIKey | IMXPMJGXHMPXQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |