C11H16Cl3NO2S2 — CID 114149844
2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)thiophene-3-sulfonamide (PubChem CID 114149844) has the molecular formula C11H16Cl3NO2S2 and a molecular weight of 364.75 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114149844 |
| Molecular Formula | C11H16Cl3NO2S2 |
| Molecular Weight | 364.75 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)thiophene-3-sulfonamide |
| SMILES | CC(C)(CCCCl)CNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H16Cl3NO2S2/c1-11(2,4-3-5-12)7-15-19(16,17)8-6-9(13)18-10(8)14/h6,15H,3-5,7H2,1-2H3 |
| InChIKey | AQYVHJNHMVZLCJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|