C13H18ClF2NO2S — CID 106146125
N-(5-chloro-2,2-dimethylpentyl)-3,4-difluorobenzenesulfonamide (PubChem CID 106146125) has the molecular formula C13H18ClF2NO2S and a molecular weight of 325.81 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106146125 |
| Molecular Formula | C13H18ClF2NO2S |
| Molecular Weight | 325.81 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-3,4-difluorobenzenesulfonamide |
| SMILES | CC(C)(CCCCl)CNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18ClF2NO2S/c1-13(2,6-3-7-14)9-17-20(18,19)10-4-5-11(15)12(16)8-10/h4-5,8,17H,3,6-7,9H2,1-2H3 |
| InChIKey | CIHMTJAYERPCDY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|