C15H23BrFNO2S — CID 107650334
4-bromo-N-(2,2-dimethylheptyl)-3-fluorobenzenesulfonamide (PubChem CID 107650334) has the molecular formula C15H23BrFNO2S and a molecular weight of 380.32 g/mol. Its IUPAC name is 4-bromo-N-(2,2-dimethylheptyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(2,2-dimethylheptyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107650334 |
| Molecular Formula | C15H23BrFNO2S |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-bromo-N-(2,2-dimethylheptyl)-3-fluorobenzenesulfonamide |
| SMILES | CCCCCC(C)(C)CNS(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H23BrFNO2S/c1-4-5-6-9-15(2,3)11-18-21(19,20)12-7-8-13(16)14(17)10-12/h7-8,10,18H,4-6,9,11H2,1-3H3 |
| InChIKey | DMIOZBJYIKDZRT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|