C15H23N3O2S — CID 115690391
6-cyano-N-(2,2-dimethylheptyl)pyridine-3-sulfonamide (PubChem CID 115690391) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 6-cyano-N-(2,2-dimethylheptyl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(2,2-dimethylheptyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115690391 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 6-cyano-N-(2,2-dimethylheptyl)pyridine-3-sulfonamide |
| SMILES | CCCCCC(C)(C)CNS(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C15H23N3O2S/c1-4-5-6-9-15(2,3)12-18-21(19,20)14-8-7-13(10-16)17-11-14/h7-8,11,18H,4-6,9,12H2,1-3H3 |
| InChIKey | QZCSZXBZKKLEIN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|