C10H13BrFNO4S2 — CID 113242592
4-bromo-N-(2-ethylsulfonylethyl)-3-fluorobenzenesulfonamide (PubChem CID 113242592) has the molecular formula C10H13BrFNO4S2 and a molecular weight of 374.25 g/mol. Its IUPAC name is 4-bromo-N-(2-ethylsulfonylethyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(2-ethylsulfonylethyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113242592 |
| Molecular Formula | C10H13BrFNO4S2 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 4-bromo-N-(2-ethylsulfonylethyl)-3-fluorobenzenesulfonamide |
| SMILES | CCS(=O)(=O)CCNS(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C10H13BrFNO4S2/c1-2-18(14,15)6-5-13-19(16,17)8-3-4-9(11)10(12)7-8/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | YTPLGYCZUOKWRP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |