C12H15BrFNO3S — CID 113242600
4-bromo-N-[2-(cyclopropylmethoxy)ethyl]-3-fluorobenzenesulfonamide (PubChem CID 113242600) has the molecular formula C12H15BrFNO3S and a molecular weight of 352.23 g/mol. Its IUPAC name is 4-bromo-N-[2-(cyclopropylmethoxy)ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(cyclopropylmethoxy)ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113242600 |
| Molecular Formula | C12H15BrFNO3S |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 4-bromo-N-[2-(cyclopropylmethoxy)ethyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCOCC1CC1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFNO3S/c13-11-4-3-10(7-12(11)14)19(16,17)15-5-6-18-8-9-1-2-9/h3-4,7,9,15H,1-2,5-6,8H2 |
| InChIKey | LWMTVXWOHPBGIW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|