C13H15BrFNO2S — CID 103844649
4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluorobenzenesulfonamide (PubChem CID 103844649) has the molecular formula C13H15BrFNO2S and a molecular weight of 348.24 g/mol. Its IUPAC name is 4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103844649 |
| Molecular Formula | C13H15BrFNO2S |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCC1=CCCC1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H15BrFNO2S/c14-12-6-5-11(9-13(12)15)19(17,18)16-8-7-10-3-1-2-4-10/h3,5-6,9,16H,1-2,4,7-8H2 |
| InChIKey | GDOVPUJYAUKGEL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|