C15H25NO2S — CID 106714769
2,2-dimethyl-6-(3-methylphenyl)sulfonylhexan-1-amine (PubChem CID 106714769) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-methylphenyl)sulfonylhexan-1-amine.
| Compound Name | 2,2-dimethyl-6-(3-methylphenyl)sulfonylhexan-1-amine |
|---|---|
| PubChem CID | 106714769 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2,2-dimethyl-6-(3-methylphenyl)sulfonylhexan-1-amine |
| SMILES | Cc1cccc(S(=O)(=O)CCCCC(C)(C)CN)c1 |
| InChI | InChI=1S/C15H25NO2S/c1-13-7-6-8-14(11-13)19(17,18)10-5-4-9-15(2,3)12-16/h6-8,11H,4-5,9-10,12,16H2,1-3H3 |
| InChIKey | IADVCBPOAMTCAF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|