C12H18BrNO2S — CID 65256667
4-(3-bromophenyl)sulfonyl-2,2-dimethylbutan-1-amine (PubChem CID 65256667) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is 4-(3-bromophenyl)sulfonyl-2,2-dimethylbutan-1-amine.
| Compound Name | 4-(3-bromophenyl)sulfonyl-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 65256667 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-(3-bromophenyl)sulfonyl-2,2-dimethylbutan-1-amine |
| SMILES | CC(C)(CN)CCS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrNO2S/c1-12(2,9-14)6-7-17(15,16)11-5-3-4-10(13)8-11/h3-5,8H,6-7,9,14H2,1-2H3 |
| InChIKey | GFHPPKAUQIWKTR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |