C11H16BrNO2S — CID 58531760
3-(3-bromophenyl)sulfonyl-N,N-dimethylpropan-1-amine (PubChem CID 58531760) has the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. Its IUPAC name is 3-(3-bromophenyl)sulfonyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-bromophenyl)sulfonyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 58531760 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-(3-bromophenyl)sulfonyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO2S/c1-13(2)7-4-8-16(14,15)11-6-3-5-10(12)9-11/h3,5-6,9H,4,7-8H2,1-2H3 |
| InChIKey | GFZXLBHHFPSESP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |